C19H24N6O4 — CID 67210289
4-[[4-[2-(3-hydroxypropyl)piperidin-1-yl]-5-nitropyrimidin-2-yl]amino]benzamide (PubChem CID 67210289) has the molecular formula C19H24N6O4 and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-[[4-[2-(3-hydroxypropyl)piperidin-1-yl]-5-nitropyrimidin-2-yl]amino]benzamide.
| Compound Name | 4-[[4-[2-(3-hydroxypropyl)piperidin-1-yl]-5-nitropyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 67210289 |
| Molecular Formula | C19H24N6O4 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 4-[[4-[2-(3-hydroxypropyl)piperidin-1-yl]-5-nitropyrimidin-2-yl]amino]benzamide |
| SMILES | NC(=O)c1ccc(Nc2ncc([N+](=O)[O-])c(N3CCCCC3CCCO)n2)cc1 |
| InChI | InChI=1S/C19H24N6O4/c20-17(27)13-6-8-14(9-7-13)22-19-21-12-16(25(28)29)18(23-19)24-10-2-1-4-15(24)5-3-11-26/h6-9,12,15,26H,1-5,10-11H2,(H2,20,27)(H,21,22,23) |
| InChIKey | FWNITTOZSOQMJI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|