C15H14INO4 — CID 67210301
2-(3,4-dimethoxyphenyl)-5-iodo-6,7-dihydro-5H-1,3-benzoxazol-4-one (PubChem CID 67210301) has the molecular formula C15H14INO4 and a molecular weight of 399.18 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-iodo-6,7-dihydro-5H-1,3-benzoxazol-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-iodo-6,7-dihydro-5H-1,3-benzoxazol-4-one |
|---|---|
| PubChem CID | 67210301 |
| Molecular Formula | C15H14INO4 |
| Molecular Weight | 399.18 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-iodo-6,7-dihydro-5H-1,3-benzoxazol-4-one |
| SMILES | COc1ccc(-c2nc3c(o2)CCC(I)C3=O)cc1OC |
| InChI | InChI=1S/C15H14INO4/c1-19-10-5-3-8(7-12(10)20-2)15-17-13-11(21-15)6-4-9(16)14(13)18/h3,5,7,9H,4,6H2,1-2H3 |
| InChIKey | DRBQDCRYXNEGNW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|