C19H17NO — CID 67210474
(2E)-2-[6-(hydroxymethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]propanenitrile (PubChem CID 67210474) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is (2E)-2-[6-(hydroxymethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]propanenitrile.
| Compound Name | (2E)-2-[6-(hydroxymethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]propanenitrile |
|---|---|
| PubChem CID | 67210474 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (2E)-2-[6-(hydroxymethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]propanenitrile |
| SMILES | C/C(C#N)=C1/c2ccccc2CCc2cc(CO)ccc21 |
| InChI | InChI=1S/C19H17NO/c1-13(11-20)19-17-5-3-2-4-15(17)7-8-16-10-14(12-21)6-9-18(16)19/h2-6,9-10,21H,7-8,12H2,1H3/b19-13+ |
| InChIKey | JDMUTMGMSWEBIA-CPNJWEJPSA-N |
| XLogP | 3.62 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|