C33H27N3O — CID 67210595
(2E)-2-[6-[[2-(hydroxymethyl)-4-methyl-6-phenylbenzimidazol-1-yl]methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]acetonitrile (PubChem CID 67210595) has the molecular formula C33H27N3O and a molecular weight of 481.60 g/mol. Its IUPAC name is (2E)-2-[6-[[2-(hydroxymethyl)-4-methyl-6-phenylbenzimidazol-1-yl]methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]acetonitrile.
| Compound Name | (2E)-2-[6-[[2-(hydroxymethyl)-4-methyl-6-phenylbenzimidazol-1-yl]methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]acetonitrile |
|---|---|
| PubChem CID | 67210595 |
| Molecular Formula | C33H27N3O |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | (2E)-2-[6-[[2-(hydroxymethyl)-4-methyl-6-phenylbenzimidazol-1-yl]methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]acetonitrile |
| SMILES | Cc1cc(-c2ccccc2)cc2c1nc(CO)n2Cc1ccc2c(c1)CCc1ccccc1/C2=C\C#N |
| InChI | InChI=1S/C33H27N3O/c1-22-17-27(24-7-3-2-4-8-24)19-31-33(22)35-32(21-37)36(31)20-23-11-14-29-26(18-23)13-12-25-9-5-6-10-28(25)30(29)15-16-34/h2-11,14-15,17-19,37H,12-13,20-21H2,1H3/b30-15+ |
| InChIKey | VRLYQJIPBAQNTN-FJEPWZHXSA-N |
| XLogP | 6.61 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|