C30H24N4O2 — CID 67210757
5-[(E)-[6-[(3-phenoxyphenoxy)methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]methyl]-2H-tetrazole (PubChem CID 67210757) has the molecular formula C30H24N4O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 5-[(E)-[6-[(3-phenoxyphenoxy)methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]methyl]-2H-tetrazole.
| Compound Name | 5-[(E)-[6-[(3-phenoxyphenoxy)methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]methyl]-2H-tetrazole |
|---|---|
| PubChem CID | 67210757 |
| Molecular Formula | C30H24N4O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 5-[(E)-[6-[(3-phenoxyphenoxy)methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]methyl]-2H-tetrazole |
| SMILES | C(=C1\c2ccccc2CCc2cc(COc3cccc(Oc4ccccc4)c3)ccc21)\c1nn[nH]n1 |
| InChI | InChI=1S/C30H24N4O2/c1-2-8-24(9-3-1)36-26-11-6-10-25(18-26)35-20-21-13-16-28-23(17-21)15-14-22-7-4-5-12-27(22)29(28)19-30-31-33-34-32-30/h1-13,16-19H,14-15,20H2,(H,31,32,33,34)/b29-19+ |
| InChIKey | TZLGXLKCDNZIRJ-VUTHCHCSSA-N |
| XLogP | 6.26 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|