C32H29N5O — CID 67210918
2-[6-[[4-methyl-6-(5-methyl-1,3,4-oxadiazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]acetonitrile (PubChem CID 67210918) has the molecular formula C32H29N5O and a molecular weight of 499.62 g/mol. Its IUPAC name is 2-[6-[[4-methyl-6-(5-methyl-1,3,4-oxadiazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]acetonitrile.
| Compound Name | 2-[6-[[4-methyl-6-(5-methyl-1,3,4-oxadiazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]acetonitrile |
|---|---|
| PubChem CID | 67210918 |
| Molecular Formula | C32H29N5O |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 2-[6-[[4-methyl-6-(5-methyl-1,3,4-oxadiazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]acetonitrile |
| SMILES | CCCc1nc2c(C)cc(-c3nnc(C)o3)cc2n1Cc1ccc2c(c1)CCc1ccccc1C2=CC#N |
| InChI | InChI=1S/C32H29N5O/c1-4-7-30-34-31-20(2)16-25(32-36-35-21(3)38-32)18-29(31)37(30)19-22-10-13-27-24(17-22)12-11-23-8-5-6-9-26(23)28(27)14-15-33/h5-6,8-10,13-14,16-18H,4,7,11-12,19H2,1-3H3 |
| InChIKey | PMSXSVJKRNIHFM-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 80.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|