C29H27N3O — CID 67211124
(2E)-2-[8-[(2-tert-butylbenzimidazol-1-yl)methyl]-6H-benzo[c][1]benzoxepin-11-ylidene]propanenitrile (PubChem CID 67211124) has the molecular formula C29H27N3O and a molecular weight of 433.56 g/mol. Its IUPAC name is (2E)-2-[8-[(2-tert-butylbenzimidazol-1-yl)methyl]-6H-benzo[c][1]benzoxepin-11-ylidene]propanenitrile.
| Compound Name | (2E)-2-[8-[(2-tert-butylbenzimidazol-1-yl)methyl]-6H-benzo[c][1]benzoxepin-11-ylidene]propanenitrile |
|---|---|
| PubChem CID | 67211124 |
| Molecular Formula | C29H27N3O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | (2E)-2-[8-[(2-tert-butylbenzimidazol-1-yl)methyl]-6H-benzo[c][1]benzoxepin-11-ylidene]propanenitrile |
| SMILES | C/C(C#N)=C1/c2ccc(Cn3c(C(C)(C)C)nc4ccccc43)cc2COc2ccccc21 |
| InChI | InChI=1S/C29H27N3O/c1-19(16-30)27-22-14-13-20(15-21(22)18-33-26-12-8-5-9-23(26)27)17-32-25-11-7-6-10-24(25)31-28(32)29(2,3)4/h5-15H,17-18H2,1-4H3/b27-19+ |
| InChIKey | HEIQLMBFMRZPKJ-ZXVVBBHZSA-N |
| XLogP | 6.62 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|