C16H12BrClN2O4S2 — CID 67211275
2-bromo-3-[2-(5-carboxy-1,3-thiazol-2-yl)ethyl]-4-(3-chlorophenyl)-2H-1,3-thiazole-5-carboxylic acid (PubChem CID 67211275) has the molecular formula C16H12BrClN2O4S2 and a molecular weight of 475.77 g/mol. Its IUPAC name is 2-bromo-3-[2-(5-carboxy-1,3-thiazol-2-yl)ethyl]-4-(3-chlorophenyl)-2H-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-bromo-3-[2-(5-carboxy-1,3-thiazol-2-yl)ethyl]-4-(3-chlorophenyl)-2H-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 67211275 |
| Molecular Formula | C16H12BrClN2O4S2 |
| Molecular Weight | 475.77 g/mol |
| Exact Mass | 473.91 |
| IUPAC Name | 2-bromo-3-[2-(5-carboxy-1,3-thiazol-2-yl)ethyl]-4-(3-chlorophenyl)-2H-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)C1=C(c2cccc(Cl)c2)N(CCc2ncc(C(=O)O)s2)C(Br)S1 |
| InChI | InChI=1S/C16H12BrClN2O4S2/c17-16-20(5-4-11-19-7-10(25-11)14(21)22)12(13(26-16)15(23)24)8-2-1-3-9(18)6-8/h1-3,6-7,16H,4-5H2,(H,21,22)(H,23,24) |
| InChIKey | KARHXSVWYXCMLJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.77 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|