C28H22N4O — CID 67211323
5-[(E)-[6-(naphthalen-2-yloxymethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]methyl]-2H-tetrazole (PubChem CID 67211323) has the molecular formula C28H22N4O and a molecular weight of 430.51 g/mol. Its IUPAC name is 5-[(E)-[6-(naphthalen-2-yloxymethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]methyl]-2H-tetrazole.
| Compound Name | 5-[(E)-[6-(naphthalen-2-yloxymethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]methyl]-2H-tetrazole |
|---|---|
| PubChem CID | 67211323 |
| Molecular Formula | C28H22N4O |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 5-[(E)-[6-(naphthalen-2-yloxymethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]methyl]-2H-tetrazole |
| SMILES | C(=C1\c2ccccc2CCc2cc(COc3ccc4ccccc4c3)ccc21)\c1nn[nH]n1 |
| InChI | InChI=1S/C28H22N4O/c1-2-7-22-16-24(13-12-20(22)5-1)33-18-19-9-14-26-23(15-19)11-10-21-6-3-4-8-25(21)27(26)17-28-29-31-32-30-28/h1-9,12-17H,10-11,18H2,(H,29,30,31,32)/b27-17+ |
| InChIKey | PQANYVANPKKZPM-WPWMEQJKSA-N |
| XLogP | 5.62 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|