About acetonitrile;2-(oxolan-2-yl)acetic acid
acetonitrile;2-(oxolan-2-yl)acetic acid (PubChem CID 67212386) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is acetonitrile;2-(oxolan-2-yl)acetic acid.
Molecular Properties
| Compound Name | acetonitrile;2-(oxolan-2-yl)acetic acid |
| PubChem CID | 67212386 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | acetonitrile;2-(oxolan-2-yl)acetic acid |
| SMILES | CC#N.O=C(O)CC1CCCO1 |
| InChI | InChI=1S/C6H10O3.C2H3N/c7-6(8)4-5-2-1-3-9-5;1-2-3/h5H,1-4H2,(H,7,8);1H3 |
| InChIKey | BOGUJKRZZPTPOK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetonitrile;2-(oxolan-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;2-(oxolan-2-yl)acetic acid?
The IUPAC name of acetonitrile;2-(oxolan-2-yl)acetic acid (CID 67212386) is acetonitrile;2-(oxolan-2-yl)acetic acid.
What is the SMILES notation for acetonitrile;2-(oxolan-2-yl)acetic acid?
The canonical SMILES for acetonitrile;2-(oxolan-2-yl)acetic acid is CC#N.O=C(O)CC1CCCO1.
What is the InChIKey of acetonitrile;2-(oxolan-2-yl)acetic acid?
The InChIKey is BOGUJKRZZPTPOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C2H3N/c7-6(8)4-5-2-1-3-9-5;1-2-3/h5H,1-4H2,(H,7,8);1H3.
What are the key properties of acetonitrile;2-(oxolan-2-yl)acetic acid?
acetonitrile;2-(oxolan-2-yl)acetic acid has a molecular weight of 171.20 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;2-(oxolan-2-yl)acetic acid is sourced from PubChem (CID 67212386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).