About 9-methyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane
9-methyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane (PubChem CID 67212442) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 9-methyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane.
Molecular Properties
| Compound Name | 9-methyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane |
| PubChem CID | 67212442 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 9-methyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane |
| SMILES | CN1C2CNCC1COC2 |
| InChI | InChI=1S/C7H14N2O/c1-9-6-2-8-3-7(9)5-10-4-6/h6-8H,2-5H2,1H3 |
| InChIKey | OOZWMPOUEKJOCJ-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-methyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane?
The IUPAC name of 9-methyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane (CID 67212442) is 9-methyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane.
What is the SMILES notation for 9-methyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane?
The canonical SMILES for 9-methyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane is CN1C2CNCC1COC2.
What is the InChIKey of 9-methyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane?
The InChIKey is OOZWMPOUEKJOCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O/c1-9-6-2-8-3-7(9)5-10-4-6/h6-8H,2-5H2,1H3.
What are the key properties of 9-methyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane?
9-methyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane has a molecular weight of 142.20 g/mol, XLogP of -0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane is sourced from PubChem (CID 67212442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).