About 4-methoxy-2,3-dihydro-1-benzofuran-3-amine
4-methoxy-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 67212522) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 4-methoxy-2,3-dihydro-1-benzofuran-3-amine.
Molecular Properties
| Compound Name | 4-methoxy-2,3-dihydro-1-benzofuran-3-amine |
| PubChem CID | 67212522 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 4-methoxy-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | COc1cccc2c1C(N)CO2 |
| InChI | InChI=1S/C9H11NO2/c1-11-7-3-2-4-8-9(7)6(10)5-12-8/h2-4,6H,5,10H2,1H3 |
| InChIKey | HJDRZCNWTNXKQN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-2,3-dihydro-1-benzofuran-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,3-dihydro-1-benzofuran-3-amine?
The IUPAC name of 4-methoxy-2,3-dihydro-1-benzofuran-3-amine (CID 67212522) is 4-methoxy-2,3-dihydro-1-benzofuran-3-amine.
What is the SMILES notation for 4-methoxy-2,3-dihydro-1-benzofuran-3-amine?
The canonical SMILES for 4-methoxy-2,3-dihydro-1-benzofuran-3-amine is COc1cccc2c1C(N)CO2.
What is the InChIKey of 4-methoxy-2,3-dihydro-1-benzofuran-3-amine?
The InChIKey is HJDRZCNWTNXKQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-11-7-3-2-4-8-9(7)6(10)5-12-8/h2-4,6H,5,10H2,1H3.
What are the key properties of 4-methoxy-2,3-dihydro-1-benzofuran-3-amine?
4-methoxy-2,3-dihydro-1-benzofuran-3-amine has a molecular weight of 165.19 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,3-dihydro-1-benzofuran-3-amine is sourced from PubChem (CID 67212522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).