About CID 67212686
CID 67212686 (PubChem CID 67212686) has the molecular formula C16H14BrLiN3O2S
and a molecular weight of 399.22 g/mol.
Molecular Properties
| Compound Name | CID 67212686 |
| PubChem CID | 67212686 |
| Molecular Formula | C16H14BrLiN3O2S |
| Molecular Weight | 399.22 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | — |
| SMILES | CC(C)(Sc1nnc(Br)n1-c1cccc2ccccc12)C(=O)O.[Li] |
| InChI | InChI=1S/C16H14BrN3O2S.Li/c1-16(2,13(21)22)23-15-19-18-14(17)20(15)12-9-5-7-10-6-3-4-8-11(10)12;/h3-9H,1-2H3,(H,21,22); |
| InChIKey | GVJWQLAEMPFICX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 67212686 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67212686?
The IUPAC name of CID 67212686 (CID 67212686) is not available.
What is the SMILES notation for CID 67212686?
The canonical SMILES for CID 67212686 is CC(C)(Sc1nnc(Br)n1-c1cccc2ccccc12)C(=O)O.[Li].
What is the InChIKey of CID 67212686?
The InChIKey is GVJWQLAEMPFICX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrN3O2S.Li/c1-16(2,13(21)22)23-15-19-18-14(17)20(15)12-9-5-7-10-6-3-4-8-11(10)12;/h3-9H,1-2H3,(H,21,22);.
What are the key properties of CID 67212686?
CID 67212686 has a molecular weight of 399.22 g/mol, XLogP of 3.76, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67212686 is sourced from PubChem (CID 67212686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).