C12H22ClN3O — CID 67212815
8-chloro-2,2-dimethyl-4-(1,2,4-triazol-1-yl)octan-3-ol (PubChem CID 67212815) has the molecular formula C12H22ClN3O and a molecular weight of 259.78 g/mol. Its IUPAC name is 8-chloro-2,2-dimethyl-4-(1,2,4-triazol-1-yl)octan-3-ol.
| Compound Name | 8-chloro-2,2-dimethyl-4-(1,2,4-triazol-1-yl)octan-3-ol |
|---|---|
| PubChem CID | 67212815 |
| Molecular Formula | C12H22ClN3O |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 8-chloro-2,2-dimethyl-4-(1,2,4-triazol-1-yl)octan-3-ol |
| SMILES | CC(C)(C)C(O)C(CCCCCl)n1cncn1 |
| InChI | InChI=1S/C12H22ClN3O/c1-12(2,3)11(17)10(6-4-5-7-13)16-9-14-8-15-16/h8-11,17H,4-7H2,1-3H3 |
| InChIKey | DASOKTKMZLYKKR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|