About 4-hydroxy-2-(3-nitro-4-phenoxyphenyl)-3aH-[1,3]thiazolo[5,4-d]pyrimidine
4-hydroxy-2-(3-nitro-4-phenoxyphenyl)-3aH-[1,3]thiazolo[5,4-d]pyrimidine (PubChem CID 67212971) has the molecular formula C17H12N4O4S
and a molecular weight of 368.37 g/mol. Its IUPAC name is 4-hydroxy-2-(3-nitro-4-phenoxyphenyl)-3aH-[1,3]thiazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4-hydroxy-2-(3-nitro-4-phenoxyphenyl)-3aH-[1,3]thiazolo[5,4-d]pyrimidine |
| PubChem CID | 67212971 |
| Molecular Formula | C17H12N4O4S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 4-hydroxy-2-(3-nitro-4-phenoxyphenyl)-3aH-[1,3]thiazolo[5,4-d]pyrimidine |
| SMILES | O=[N+]([O-])c1cc(C2=NC3=CN=CN(O)C3S2)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C17H12N4O4S/c22-20-10-18-9-13-17(20)26-16(19-13)11-6-7-15(14(8-11)21(23)24)25-12-4-2-1-3-5-12/h1-10,17,22H |
| InChIKey | VFLZEAQHRUVWMP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 100.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-2-(3-nitro-4-phenoxyphenyl)-3aH-[1,3]thiazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2-(3-nitro-4-phenoxyphenyl)-3aH-[1,3]thiazolo[5,4-d]pyrimidine?
The IUPAC name of 4-hydroxy-2-(3-nitro-4-phenoxyphenyl)-3aH-[1,3]thiazolo[5,4-d]pyrimidine (CID 67212971) is 4-hydroxy-2-(3-nitro-4-phenoxyphenyl)-3aH-[1,3]thiazolo[5,4-d]pyrimidine.
What is the SMILES notation for 4-hydroxy-2-(3-nitro-4-phenoxyphenyl)-3aH-[1,3]thiazolo[5,4-d]pyrimidine?
The canonical SMILES for 4-hydroxy-2-(3-nitro-4-phenoxyphenyl)-3aH-[1,3]thiazolo[5,4-d]pyrimidine is O=[N+]([O-])c1cc(C2=NC3=CN=CN(O)C3S2)ccc1Oc1ccccc1.
What is the InChIKey of 4-hydroxy-2-(3-nitro-4-phenoxyphenyl)-3aH-[1,3]thiazolo[5,4-d]pyrimidine?
The InChIKey is VFLZEAQHRUVWMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N4O4S/c22-20-10-18-9-13-17(20)26-16(19-13)11-6-7-15(14(8-11)21(23)24)25-12-4-2-1-3-5-12/h1-10,17,22H.
What are the key properties of 4-hydroxy-2-(3-nitro-4-phenoxyphenyl)-3aH-[1,3]thiazolo[5,4-d]pyrimidine?
4-hydroxy-2-(3-nitro-4-phenoxyphenyl)-3aH-[1,3]thiazolo[5,4-d]pyrimidine has a molecular weight of 368.37 g/mol, XLogP of 3.78, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2-(3-nitro-4-phenoxyphenyl)-3aH-[1,3]thiazolo[5,4-d]pyrimidine is sourced from PubChem (CID 67212971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).