About 5-(thiolan-2-yl)-1H-1,2,4-triazole
5-(thiolan-2-yl)-1H-1,2,4-triazole (PubChem CID 67213191) has the molecular formula C6H9N3S
and a molecular weight of 155.23 g/mol. Its IUPAC name is 5-(thiolan-2-yl)-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 5-(thiolan-2-yl)-1H-1,2,4-triazole |
| PubChem CID | 67213191 |
| Molecular Formula | C6H9N3S |
| Molecular Weight | 155.23 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 5-(thiolan-2-yl)-1H-1,2,4-triazole |
| SMILES | c1n[nH]c(C2CCCS2)n1 |
| InChI | InChI=1S/C6H9N3S/c1-2-5(10-3-1)6-7-4-8-9-6/h4-5H,1-3H2,(H,7,8,9) |
| InChIKey | RTFRIKHRAGVHKH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(thiolan-2-yl)-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(thiolan-2-yl)-1H-1,2,4-triazole?
The IUPAC name of 5-(thiolan-2-yl)-1H-1,2,4-triazole (CID 67213191) is 5-(thiolan-2-yl)-1H-1,2,4-triazole.
What is the SMILES notation for 5-(thiolan-2-yl)-1H-1,2,4-triazole?
The canonical SMILES for 5-(thiolan-2-yl)-1H-1,2,4-triazole is c1n[nH]c(C2CCCS2)n1.
What is the InChIKey of 5-(thiolan-2-yl)-1H-1,2,4-triazole?
The InChIKey is RTFRIKHRAGVHKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3S/c1-2-5(10-3-1)6-7-4-8-9-6/h4-5H,1-3H2,(H,7,8,9).
What are the key properties of 5-(thiolan-2-yl)-1H-1,2,4-triazole?
5-(thiolan-2-yl)-1H-1,2,4-triazole has a molecular weight of 155.23 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(thiolan-2-yl)-1H-1,2,4-triazole is sourced from PubChem (CID 67213191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).