C37H31Cl2N11O2 — CID 67213266
7-chloro-N,N,9-trimethyl-2-pyrazin-2-ylpyrimido[4,5-b]indole-4-carboxamide;7-chloro-N,N,9-trimethyl-2-pyridin-2-ylpyrimido[4,5-b]indole-4-carboxamide (PubChem CID 67213266) has the molecular formula C37H31Cl2N11O2 and a molecular weight of 732.64 g/mol. Its IUPAC name is 7-chloro-N,N,9-trimethyl-2-pyrazin-2-ylpyrimido[4,5-b]indole-4-carboxamide;7-chloro-N,N,9-trimethyl-2-pyridin-2-ylpyrimido[4,5-b]indole-4-carboxamide.
| Compound Name | 7-chloro-N,N,9-trimethyl-2-pyrazin-2-ylpyrimido[4,5-b]indole-4-carboxamide;7-chloro-N,N,9-trimethyl-2-pyridin-2-ylpyrimido[4,5-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 67213266 |
| Molecular Formula | C37H31Cl2N11O2 |
| Molecular Weight | 732.64 g/mol |
| Exact Mass | 731.20 |
| IUPAC Name | 7-chloro-N,N,9-trimethyl-2-pyrazin-2-ylpyrimido[4,5-b]indole-4-carboxamide;7-chloro-N,N,9-trimethyl-2-pyridin-2-ylpyrimido[4,5-b]indole-4-carboxamide |
| SMILES | CN(C)C(=O)c1nc(-c2ccccn2)nc2c1c1ccc(Cl)cc1n2C.CN(C)C(=O)c1nc(-c2cnccn2)nc2c1c1ccc(Cl)cc1n2C |
| InChI | InChI=1S/C19H16ClN5O.C18H15ClN6O/c1-24(2)19(26)16-15-12-8-7-11(20)10-14(12)25(3)18(15)23-17(22-16)13-6-4-5-9-21-13;1-24(2)18(26)15-14-11-5-4-10(19)8-13(11)25(3)17(14)23-16(22-15)12-9-20-6-7-21-12/h4-10H,1-3H3;4-9H,1-3H3 |
| InChIKey | BCTJYFJOWAHVCL-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 140.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.64 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |