C23H26Br2N2O9S2 — CID 67214142
bis[2-[(2-bromophenyl)sulfonylamino]oxan-4-yl] carbonate (PubChem CID 67214142) has the molecular formula C23H26Br2N2O9S2 and a molecular weight of 698.41 g/mol. Its IUPAC name is bis[2-[(2-bromophenyl)sulfonylamino]oxan-4-yl] carbonate.
| Compound Name | bis[2-[(2-bromophenyl)sulfonylamino]oxan-4-yl] carbonate |
|---|---|
| PubChem CID | 67214142 |
| Molecular Formula | C23H26Br2N2O9S2 |
| Molecular Weight | 698.41 g/mol |
| Exact Mass | 695.94 |
| IUPAC Name | bis[2-[(2-bromophenyl)sulfonylamino]oxan-4-yl] carbonate |
| SMILES | O=C(OC1CCOC(NS(=O)(=O)c2ccccc2Br)C1)OC1CCOC(NS(=O)(=O)c2ccccc2Br)C1 |
| InChI | InChI=1S/C23H26Br2N2O9S2/c24-17-5-1-3-7-19(17)37(29,30)26-21-13-15(9-11-33-21)35-23(28)36-16-10-12-34-22(14-16)27-38(31,32)20-8-4-2-6-18(20)25/h1-8,15-16,21-22,26-27H,9-14H2 |
| InChIKey | RANWUDOMCSZBPU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |