About 4-[2-[(S)-cyclohexyl-(cyclohexylamino)methyl]-1H-imidazol-5-yl]-N,N-diethylaniline
4-[2-[(S)-cyclohexyl-(cyclohexylamino)methyl]-1H-imidazol-5-yl]-N,N-diethylaniline (PubChem CID 67214282) has the molecular formula C26H40N4
and a molecular weight of 408.63 g/mol. Its IUPAC name is 4-[2-[(S)-cyclohexyl-(cyclohexylamino)methyl]-1H-imidazol-5-yl]-N,N-diethylaniline.
Molecular Properties
| Compound Name | 4-[2-[(S)-cyclohexyl-(cyclohexylamino)methyl]-1H-imidazol-5-yl]-N,N-diethylaniline |
| PubChem CID | 67214282 |
| Molecular Formula | C26H40N4 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.33 |
| IUPAC Name | 4-[2-[(S)-cyclohexyl-(cyclohexylamino)methyl]-1H-imidazol-5-yl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(-c2cnc([C@@H](NC3CCCCC3)C3CCCCC3)[nH]2)cc1 |
| InChI | InChI=1S/C26H40N4/c1-3-30(4-2)23-17-15-20(16-18-23)24-19-27-26(29-24)25(21-11-7-5-8-12-21)28-22-13-9-6-10-14-22/h15-19,21-22,25,28H,3-14H2,1-2H3,(H,27,29)/t25-/m0/s1 |
| InChIKey | RLRFQPPTKIWYGL-VWLOTQADSA-N |
| XLogP | 6.47 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-[(S)-cyclohexyl-(cyclohexylamino)methyl]-1H-imidazol-5-yl]-N,N-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(S)-cyclohexyl-(cyclohexylamino)methyl]-1H-imidazol-5-yl]-N,N-diethylaniline?
The IUPAC name of 4-[2-[(S)-cyclohexyl-(cyclohexylamino)methyl]-1H-imidazol-5-yl]-N,N-diethylaniline (CID 67214282) is 4-[2-[(S)-cyclohexyl-(cyclohexylamino)methyl]-1H-imidazol-5-yl]-N,N-diethylaniline.
What is the SMILES notation for 4-[2-[(S)-cyclohexyl-(cyclohexylamino)methyl]-1H-imidazol-5-yl]-N,N-diethylaniline?
The canonical SMILES for 4-[2-[(S)-cyclohexyl-(cyclohexylamino)methyl]-1H-imidazol-5-yl]-N,N-diethylaniline is CCN(CC)c1ccc(-c2cnc([C@@H](NC3CCCCC3)C3CCCCC3)[nH]2)cc1.
What is the InChIKey of 4-[2-[(S)-cyclohexyl-(cyclohexylamino)methyl]-1H-imidazol-5-yl]-N,N-diethylaniline?
The InChIKey is RLRFQPPTKIWYGL-VWLOTQADSA-N. The full InChI is InChI=1S/C26H40N4/c1-3-30(4-2)23-17-15-20(16-18-23)24-19-27-26(29-24)25(21-11-7-5-8-12-21)28-22-13-9-6-10-14-22/h15-19,21-22,25,28H,3-14H2,1-2H3,(H,27,29)/t25-/m0/s1.
What are the key properties of 4-[2-[(S)-cyclohexyl-(cyclohexylamino)methyl]-1H-imidazol-5-yl]-N,N-diethylaniline?
4-[2-[(S)-cyclohexyl-(cyclohexylamino)methyl]-1H-imidazol-5-yl]-N,N-diethylaniline has a molecular weight of 408.63 g/mol, XLogP of 6.47, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(S)-cyclohexyl-(cyclohexylamino)methyl]-1H-imidazol-5-yl]-N,N-diethylaniline is sourced from PubChem (CID 67214282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).