About cyclobutylmethyl N-[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]ethyl]carbamate
cyclobutylmethyl N-[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]ethyl]carbamate (PubChem CID 67214697) has the molecular formula C17H20FN3O2
and a molecular weight of 317.36 g/mol. Its IUPAC name is cyclobutylmethyl N-[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]ethyl]carbamate.
Molecular Properties
| Compound Name | cyclobutylmethyl N-[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]ethyl]carbamate |
| PubChem CID | 67214697 |
| Molecular Formula | C17H20FN3O2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | cyclobutylmethyl N-[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]ethyl]carbamate |
| SMILES | O=C(NCCc1ncc(-c2ccc(F)cc2)[nH]1)OCC1CCC1 |
| InChI | InChI=1S/C17H20FN3O2/c18-14-6-4-13(5-7-14)15-10-20-16(21-15)8-9-19-17(22)23-11-12-2-1-3-12/h4-7,10,12H,1-3,8-9,11H2,(H,19,22)(H,20,21) |
| InChIKey | HUSZYUDLQMQCMM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclobutylmethyl N-[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutylmethyl N-[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]ethyl]carbamate?
The IUPAC name of cyclobutylmethyl N-[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]ethyl]carbamate (CID 67214697) is cyclobutylmethyl N-[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]ethyl]carbamate.
What is the SMILES notation for cyclobutylmethyl N-[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]ethyl]carbamate?
The canonical SMILES for cyclobutylmethyl N-[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]ethyl]carbamate is O=C(NCCc1ncc(-c2ccc(F)cc2)[nH]1)OCC1CCC1.
What is the InChIKey of cyclobutylmethyl N-[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]ethyl]carbamate?
The InChIKey is HUSZYUDLQMQCMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FN3O2/c18-14-6-4-13(5-7-14)15-10-20-16(21-15)8-9-19-17(22)23-11-12-2-1-3-12/h4-7,10,12H,1-3,8-9,11H2,(H,19,22)(H,20,21).
What are the key properties of cyclobutylmethyl N-[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]ethyl]carbamate?
cyclobutylmethyl N-[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]ethyl]carbamate has a molecular weight of 317.36 g/mol, XLogP of 3.28, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutylmethyl N-[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]ethyl]carbamate is sourced from PubChem (CID 67214697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).