About butyl N-[2-[5-[4-(2,3-difluorophenyl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate
butyl N-[2-[5-[4-(2,3-difluorophenyl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate (PubChem CID 67214941) has the molecular formula C22H23F2N3O2
and a molecular weight of 399.44 g/mol. Its IUPAC name is butyl N-[2-[5-[4-(2,3-difluorophenyl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate.
Molecular Properties
| Compound Name | butyl N-[2-[5-[4-(2,3-difluorophenyl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate |
| PubChem CID | 67214941 |
| Molecular Formula | C22H23F2N3O2 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | butyl N-[2-[5-[4-(2,3-difluorophenyl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate |
| SMILES | CCCCOC(=O)NCCc1ncc(-c2ccc(-c3cccc(F)c3F)cc2)[nH]1 |
| InChI | InChI=1S/C22H23F2N3O2/c1-2-3-13-29-22(28)25-12-11-20-26-14-19(27-20)16-9-7-15(8-10-16)17-5-4-6-18(23)21(17)24/h4-10,14H,2-3,11-13H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | ZDKYTBSIKZFXQG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl N-[2-[5-[4-(2,3-difluorophenyl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl N-[2-[5-[4-(2,3-difluorophenyl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate?
The IUPAC name of butyl N-[2-[5-[4-(2,3-difluorophenyl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate (CID 67214941) is butyl N-[2-[5-[4-(2,3-difluorophenyl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate.
What is the SMILES notation for butyl N-[2-[5-[4-(2,3-difluorophenyl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate?
The canonical SMILES for butyl N-[2-[5-[4-(2,3-difluorophenyl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate is CCCCOC(=O)NCCc1ncc(-c2ccc(-c3cccc(F)c3F)cc2)[nH]1.
What is the InChIKey of butyl N-[2-[5-[4-(2,3-difluorophenyl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate?
The InChIKey is ZDKYTBSIKZFXQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23F2N3O2/c1-2-3-13-29-22(28)25-12-11-20-26-14-19(27-20)16-9-7-15(8-10-16)17-5-4-6-18(23)21(17)24/h4-10,14H,2-3,11-13H2,1H3,(H,25,28)(H,26,27).
What are the key properties of butyl N-[2-[5-[4-(2,3-difluorophenyl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate?
butyl N-[2-[5-[4-(2,3-difluorophenyl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate has a molecular weight of 399.44 g/mol, XLogP of 5.09, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl N-[2-[5-[4-(2,3-difluorophenyl)phenyl]-1H-imidazol-2-yl]ethyl]carbamate is sourced from PubChem (CID 67214941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).