C32H40BN5O5 — CID 67215257
N-[(2S)-3,3-dimethyl-1-oxo-1-[(1S,4S)-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]butan-2-yl]-1H-indole-2-carboxamide (PubChem CID 67215257) has the molecular formula C32H40BN5O5 and a molecular weight of 585.51 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethyl-1-oxo-1-[(1S,4S)-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]butan-2-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[(2S)-3,3-dimethyl-1-oxo-1-[(1S,4S)-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]butan-2-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 67215257 |
| Molecular Formula | C32H40BN5O5 |
| Molecular Weight | 585.51 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | N-[(2S)-3,3-dimethyl-1-oxo-1-[(1S,4S)-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]butan-2-yl]-1H-indole-2-carboxamide |
| SMILES | CC(C)(C)[C@H](NC(=O)c1cc2ccccc2[nH]1)C(=O)N1C[C@@H]2C[C@H]1CN2C(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C32H40BN5O5/c1-30(2,3)26(36-27(39)25-14-19-10-8-9-11-23(19)35-25)29(41)38-18-21-15-22(38)17-37(21)28(40)24-13-12-20(16-34-24)33-42-31(4,5)32(6,7)43-33/h8-14,16,21-22,26,35H,15,17-18H2,1-7H3,(H,36,39)/t21-,22-,26+/m0/s1 |
| InChIKey | ZFVRJFHDAMWNJI-AOJNWGRGSA-N |
| XLogP | 3.13 |
| TPSA | 116.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|