C8H7N5 — CID 67216423
3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-amine (PubChem CID 67216423) has the molecular formula C8H7N5 and a molecular weight of 173.18 g/mol. Its IUPAC name is 3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-amine.
| Compound Name | 3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-amine |
|---|---|
| PubChem CID | 67216423 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-amine |
| SMILES | Nc1nc2c(cnc3[nH]ccc32)[nH]1 |
| InChI | InChI=1S/C8H7N5/c9-8-12-5-3-11-7-4(1-2-10-7)6(5)13-8/h1-3H,(H,10,11)(H3,9,12,13) |
| InChIKey | BMACENNNZXXETN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |