About 1H-pyrrolo[2,3-c]pyridin-2-ylhydrazine
1H-pyrrolo[2,3-c]pyridin-2-ylhydrazine (PubChem CID 67216460) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-c]pyridin-2-ylhydrazine.
Molecular Properties
| Compound Name | 1H-pyrrolo[2,3-c]pyridin-2-ylhydrazine |
| PubChem CID | 67216460 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 1H-pyrrolo[2,3-c]pyridin-2-ylhydrazine |
| SMILES | NNc1cc2ccncc2[nH]1 |
| InChI | InChI=1S/C7H8N4/c8-11-7-3-5-1-2-9-4-6(5)10-7/h1-4,10-11H,8H2 |
| InChIKey | SEEWGXYQDRWXMM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrrolo[2,3-c]pyridin-2-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[2,3-c]pyridin-2-ylhydrazine?
The IUPAC name of 1H-pyrrolo[2,3-c]pyridin-2-ylhydrazine (CID 67216460) is 1H-pyrrolo[2,3-c]pyridin-2-ylhydrazine.
What is the SMILES notation for 1H-pyrrolo[2,3-c]pyridin-2-ylhydrazine?
The canonical SMILES for 1H-pyrrolo[2,3-c]pyridin-2-ylhydrazine is NNc1cc2ccncc2[nH]1.
What is the InChIKey of 1H-pyrrolo[2,3-c]pyridin-2-ylhydrazine?
The InChIKey is SEEWGXYQDRWXMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c8-11-7-3-5-1-2-9-4-6(5)10-7/h1-4,10-11H,8H2.
What are the key properties of 1H-pyrrolo[2,3-c]pyridin-2-ylhydrazine?
1H-pyrrolo[2,3-c]pyridin-2-ylhydrazine has a molecular weight of 148.17 g/mol, XLogP of 0.85, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[2,3-c]pyridin-2-ylhydrazine is sourced from PubChem (CID 67216460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).