About 2-spiro[4.4]nonan-4-yl-1,4-dioxane
2-spiro[4.4]nonan-4-yl-1,4-dioxane (PubChem CID 67216497) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-spiro[4.4]nonan-4-yl-1,4-dioxane.
Molecular Properties
| Compound Name | 2-spiro[4.4]nonan-4-yl-1,4-dioxane |
| PubChem CID | 67216497 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2-spiro[4.4]nonan-4-yl-1,4-dioxane |
| SMILES | C1CCC2(C1)CCCC2C1COCCO1 |
| InChI | InChI=1S/C13H22O2/c1-2-6-13(5-1)7-3-4-11(13)12-10-14-8-9-15-12/h11-12H,1-10H2 |
| InChIKey | OKDKFJCODGQHLZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-spiro[4.4]nonan-4-yl-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-spiro[4.4]nonan-4-yl-1,4-dioxane?
The IUPAC name of 2-spiro[4.4]nonan-4-yl-1,4-dioxane (CID 67216497) is 2-spiro[4.4]nonan-4-yl-1,4-dioxane.
What is the SMILES notation for 2-spiro[4.4]nonan-4-yl-1,4-dioxane?
The canonical SMILES for 2-spiro[4.4]nonan-4-yl-1,4-dioxane is C1CCC2(C1)CCCC2C1COCCO1.
What is the InChIKey of 2-spiro[4.4]nonan-4-yl-1,4-dioxane?
The InChIKey is OKDKFJCODGQHLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-2-6-13(5-1)7-3-4-11(13)12-10-14-8-9-15-12/h11-12H,1-10H2.
What are the key properties of 2-spiro[4.4]nonan-4-yl-1,4-dioxane?
2-spiro[4.4]nonan-4-yl-1,4-dioxane has a molecular weight of 210.32 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-spiro[4.4]nonan-4-yl-1,4-dioxane is sourced from PubChem (CID 67216497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).