C27H38N4O5Si — CID 67216733
tert-butyl N-[6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamate (PubChem CID 67216733) has the molecular formula C27H38N4O5Si and a molecular weight of 526.71 g/mol. Its IUPAC name is tert-butyl N-[6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamate |
|---|---|
| PubChem CID | 67216733 |
| Molecular Formula | C27H38N4O5Si |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | tert-butyl N-[6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cnc2c(cc(-c3ccc(C4(C)OCCO4)cc3)n2COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C27H38N4O5Si/c1-26(2,3)36-25(32)30-23-17-28-24-21(29-23)16-22(31(24)18-33-14-15-37(5,6)7)19-8-10-20(11-9-19)27(4)34-12-13-35-27/h8-11,16-17H,12-15,18H2,1-7H3,(H,29,30,32) |
| InChIKey | JOHCJPZVONBUTN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|