C21H21N5O2 — CID 67216743
phenyl 4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carboxylate (PubChem CID 67216743) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is phenyl 4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carboxylate.
| Compound Name | phenyl 4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67216743 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | phenyl 4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carboxylate |
| SMILES | CC1CCN(C(=O)Oc2ccccc2)CC1c1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C21H21N5O2/c1-14-8-10-25(21(27)28-16-5-3-2-4-6-16)13-17(14)20-24-12-15-11-23-19-18(26(15)20)7-9-22-19/h2-7,9,11-12,14,17,22H,8,10,13H2,1H3 |
| InChIKey | GVSVGFFEAAYUSK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |