C24H22F3N3O2S — CID 67216857
benzyl 6-[2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole-4-carboxylate (PubChem CID 67216857) has the molecular formula C24H22F3N3O2S and a molecular weight of 473.52 g/mol. Its IUPAC name is benzyl 6-[2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | benzyl 6-[2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 67216857 |
| Molecular Formula | C24H22F3N3O2S |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | benzyl 6-[2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC(c2csc(-c3cccc(C(F)(F)F)c3)n2)C2NCCC21 |
| InChI | InChI=1S/C24H22F3N3O2S/c25-24(26,27)17-8-4-7-16(11-17)22-29-19(14-33-22)18-12-30(20-9-10-28-21(18)20)23(31)32-13-15-5-2-1-3-6-15/h1-8,11,14,18,20-21,28H,9-10,12-13H2 |
| InChIKey | CYTDMXGAFHNLQU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |