C8H7N5 — CID 67216886
1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-amine (PubChem CID 67216886) has the molecular formula C8H7N5 and a molecular weight of 173.18 g/mol. Its IUPAC name is 1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-amine.
| Compound Name | 1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-amine |
|---|---|
| PubChem CID | 67216886 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-amine |
| SMILES | Nc1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C8H7N5/c9-8-12-4-5-3-11-7-6(13(5)8)1-2-10-7/h1-4,10H,(H2,9,12) |
| InChIKey | PKOMAUQDIPXQGU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |