C19H21F2N3OS — CID 67217025
(4aR,8aS)-8a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-1-methyl-2,4,4a,5,6,8-hexahydropyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 67217025) has the molecular formula C19H21F2N3OS and a molecular weight of 377.46 g/mol. Its IUPAC name is (4aR,8aS)-8a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-1-methyl-2,4,4a,5,6,8-hexahydropyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,8aS)-8a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-1-methyl-2,4,4a,5,6,8-hexahydropyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 67217025 |
| Molecular Formula | C19H21F2N3OS |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (4aR,8aS)-8a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-1-methyl-2,4,4a,5,6,8-hexahydropyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | CN1C(N)SC[C@@H]2CCOC[C@@]21c1cc(-c2cccnc2F)ccc1F |
| InChI | InChI=1S/C19H21F2N3OS/c1-24-18(22)26-10-13-6-8-25-11-19(13,24)15-9-12(4-5-16(15)20)14-3-2-7-23-17(14)21/h2-5,7,9,13,18H,6,8,10-11,22H2,1H3/t13-,18?,19-/m0/s1 |
| InChIKey | HLZVTANOIWJENH-IMWIMMFESA-N |
| XLogP | 3.18 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|