About 2-oxabicyclo[2.2.1]hepta-1(6),4-diene
2-oxabicyclo[2.2.1]hepta-1(6),4-diene (PubChem CID 67217103) has the molecular formula C6H6O
and a molecular weight of 94.11 g/mol. Its IUPAC name is 2-oxabicyclo[2.2.1]hepta-1(6),4-diene.
Molecular Properties
| Compound Name | 2-oxabicyclo[2.2.1]hepta-1(6),4-diene |
| PubChem CID | 67217103 |
| Molecular Formula | C6H6O |
| Molecular Weight | 94.11 g/mol |
| Exact Mass | 94.04 |
| IUPAC Name | 2-oxabicyclo[2.2.1]hepta-1(6),4-diene |
| SMILES | C1=C2COC(=C1)C2 |
| InChI | InChI=1S/C6H6O/c1-2-6-3-5(1)4-7-6/h1-2H,3-4H2 |
| InChIKey | BXROCGHHDZTQIX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.11 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-oxabicyclo[2.2.1]hepta-1(6),4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxabicyclo[2.2.1]hepta-1(6),4-diene?
The IUPAC name of 2-oxabicyclo[2.2.1]hepta-1(6),4-diene (CID 67217103) is 2-oxabicyclo[2.2.1]hepta-1(6),4-diene.
What is the SMILES notation for 2-oxabicyclo[2.2.1]hepta-1(6),4-diene?
The canonical SMILES for 2-oxabicyclo[2.2.1]hepta-1(6),4-diene is C1=C2COC(=C1)C2.
What is the InChIKey of 2-oxabicyclo[2.2.1]hepta-1(6),4-diene?
The InChIKey is BXROCGHHDZTQIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O/c1-2-6-3-5(1)4-7-6/h1-2H,3-4H2.
What are the key properties of 2-oxabicyclo[2.2.1]hepta-1(6),4-diene?
2-oxabicyclo[2.2.1]hepta-1(6),4-diene has a molecular weight of 94.11 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxabicyclo[2.2.1]hepta-1(6),4-diene is sourced from PubChem (CID 67217103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).