C24H42O7 — CID 67217297
1,3,3-trimethyl-6,7-bis[2-(oxan-2-yloxy)ethoxy]-2-oxabicyclo[2.2.2]octane (PubChem CID 67217297) has the molecular formula C24H42O7 and a molecular weight of 442.59 g/mol. Its IUPAC name is 1,3,3-trimethyl-6,7-bis[2-(oxan-2-yloxy)ethoxy]-2-oxabicyclo[2.2.2]octane.
| Compound Name | 1,3,3-trimethyl-6,7-bis[2-(oxan-2-yloxy)ethoxy]-2-oxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 67217297 |
| Molecular Formula | C24H42O7 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | 1,3,3-trimethyl-6,7-bis[2-(oxan-2-yloxy)ethoxy]-2-oxabicyclo[2.2.2]octane |
| SMILES | CC1(C)OC2(C)C(OCCOC3CCCCO3)CC1CC2OCCOC1CCCCO1 |
| InChI | InChI=1S/C24H42O7/c1-23(2)18-16-19(25-12-14-29-21-8-4-6-10-27-21)24(3,31-23)20(17-18)26-13-15-30-22-9-5-7-11-28-22/h18-22H,4-17H2,1-3H3 |
| InChIKey | LCRKCQUKOLQWBE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|