About methyl-[2-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]ethyl]carbamic acid
methyl-[2-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]ethyl]carbamic acid (PubChem CID 67217571) has the molecular formula C14H19N3O2
and a molecular weight of 261.32 g/mol. Its IUPAC name is methyl-[2-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]ethyl]carbamic acid.
Molecular Properties
| Compound Name | methyl-[2-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]ethyl]carbamic acid |
| PubChem CID | 67217571 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | methyl-[2-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]ethyl]carbamic acid |
| SMILES | CN(CCc1ccc(C2=NCCN2C)cc1)C(=O)O |
| InChI | InChI=1S/C14H19N3O2/c1-16-10-8-15-13(16)12-5-3-11(4-6-12)7-9-17(2)14(18)19/h3-6H,7-10H2,1-2H3,(H,18,19) |
| InChIKey | CMVYIIMVEPBPFC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl-[2-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]ethyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[2-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]ethyl]carbamic acid?
The IUPAC name of methyl-[2-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]ethyl]carbamic acid (CID 67217571) is methyl-[2-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]ethyl]carbamic acid.
What is the SMILES notation for methyl-[2-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]ethyl]carbamic acid?
The canonical SMILES for methyl-[2-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]ethyl]carbamic acid is CN(CCc1ccc(C2=NCCN2C)cc1)C(=O)O.
What is the InChIKey of methyl-[2-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]ethyl]carbamic acid?
The InChIKey is CMVYIIMVEPBPFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2/c1-16-10-8-15-13(16)12-5-3-11(4-6-12)7-9-17(2)14(18)19/h3-6H,7-10H2,1-2H3,(H,18,19).
What are the key properties of methyl-[2-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]ethyl]carbamic acid?
methyl-[2-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]ethyl]carbamic acid has a molecular weight of 261.32 g/mol, XLogP of 1.53, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[2-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]ethyl]carbamic acid is sourced from PubChem (CID 67217571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).