C15H17Cl2F3N2O3 — CID 67217709
N-(3,4-dichlorophenyl)-2-piperidin-4-ylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 67217709) has the molecular formula C15H17Cl2F3N2O3 and a molecular weight of 401.21 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-piperidin-4-ylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(3,4-dichlorophenyl)-2-piperidin-4-ylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67217709 |
| Molecular Formula | C15H17Cl2F3N2O3 |
| Molecular Weight | 401.21 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-piperidin-4-ylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(CC1CCNCC1)Nc1ccc(Cl)c(Cl)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H16Cl2N2O.C2HF3O2/c14-11-2-1-10(8-12(11)15)17-13(18)7-9-3-5-16-6-4-9;3-2(4,5)1(6)7/h1-2,8-9,16H,3-7H2,(H,17,18);(H,6,7) |
| InChIKey | XTHPHYOJIGYCDR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |