C14H10BrFN2O2 — CID 67217761
2-bromo-2-(4-fluorophenyl)-3H-imidazo[1,2-a]pyridine-3-carboxylic acid (PubChem CID 67217761) has the molecular formula C14H10BrFN2O2 and a molecular weight of 337.15 g/mol. Its IUPAC name is 2-bromo-2-(4-fluorophenyl)-3H-imidazo[1,2-a]pyridine-3-carboxylic acid.
| Compound Name | 2-bromo-2-(4-fluorophenyl)-3H-imidazo[1,2-a]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 67217761 |
| Molecular Formula | C14H10BrFN2O2 |
| Molecular Weight | 337.15 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 2-bromo-2-(4-fluorophenyl)-3H-imidazo[1,2-a]pyridine-3-carboxylic acid |
| SMILES | O=C(O)C1N2C=CC=CC2=NC1(Br)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H10BrFN2O2/c15-14(9-4-6-10(16)7-5-9)12(13(19)20)18-8-2-1-3-11(18)17-14/h1-8,12H,(H,19,20) |
| InChIKey | OYYLRKQLABMRFG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|