About 5-(2-hydroxyethylsulfamoyl)-4-methyl-1,3-thiazole-2-carboxamide
5-(2-hydroxyethylsulfamoyl)-4-methyl-1,3-thiazole-2-carboxamide (PubChem CID 67218266) has the molecular formula C7H11N3O4S2
and a molecular weight of 265.32 g/mol. Its IUPAC name is 5-(2-hydroxyethylsulfamoyl)-4-methyl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-(2-hydroxyethylsulfamoyl)-4-methyl-1,3-thiazole-2-carboxamide |
| PubChem CID | 67218266 |
| Molecular Formula | C7H11N3O4S2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 5-(2-hydroxyethylsulfamoyl)-4-methyl-1,3-thiazole-2-carboxamide |
| SMILES | Cc1nc(C(N)=O)sc1S(=O)(=O)NCCO |
| InChI | InChI=1S/C7H11N3O4S2/c1-4-7(15-6(10-4)5(8)12)16(13,14)9-2-3-11/h9,11H,2-3H2,1H3,(H2,8,12) |
| InChIKey | HBXUCRXVVZPZST-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(2-hydroxyethylsulfamoyl)-4-methyl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-hydroxyethylsulfamoyl)-4-methyl-1,3-thiazole-2-carboxamide?
The IUPAC name of 5-(2-hydroxyethylsulfamoyl)-4-methyl-1,3-thiazole-2-carboxamide (CID 67218266) is 5-(2-hydroxyethylsulfamoyl)-4-methyl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 5-(2-hydroxyethylsulfamoyl)-4-methyl-1,3-thiazole-2-carboxamide?
The canonical SMILES for 5-(2-hydroxyethylsulfamoyl)-4-methyl-1,3-thiazole-2-carboxamide is Cc1nc(C(N)=O)sc1S(=O)(=O)NCCO.
What is the InChIKey of 5-(2-hydroxyethylsulfamoyl)-4-methyl-1,3-thiazole-2-carboxamide?
The InChIKey is HBXUCRXVVZPZST-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O4S2/c1-4-7(15-6(10-4)5(8)12)16(13,14)9-2-3-11/h9,11H,2-3H2,1H3,(H2,8,12).
What are the key properties of 5-(2-hydroxyethylsulfamoyl)-4-methyl-1,3-thiazole-2-carboxamide?
5-(2-hydroxyethylsulfamoyl)-4-methyl-1,3-thiazole-2-carboxamide has a molecular weight of 265.32 g/mol, XLogP of -1.18, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-hydroxyethylsulfamoyl)-4-methyl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 67218266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).