About 2-(4,5-dimethyl-1,3-oxathiolan-2-yl)-1,3-oxathiane
2-(4,5-dimethyl-1,3-oxathiolan-2-yl)-1,3-oxathiane (PubChem CID 67218267) has the molecular formula C9H16O2S2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-(4,5-dimethyl-1,3-oxathiolan-2-yl)-1,3-oxathiane.
Molecular Properties
| Compound Name | 2-(4,5-dimethyl-1,3-oxathiolan-2-yl)-1,3-oxathiane |
| PubChem CID | 67218267 |
| Molecular Formula | C9H16O2S2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-(4,5-dimethyl-1,3-oxathiolan-2-yl)-1,3-oxathiane |
| SMILES | CC1OC(C2OCCCS2)SC1C |
| InChI | InChI=1S/C9H16O2S2/c1-6-7(2)13-9(11-6)8-10-4-3-5-12-8/h6-9H,3-5H2,1-2H3 |
| InChIKey | ULNPXBWMAOUWNQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,5-dimethyl-1,3-oxathiolan-2-yl)-1,3-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethyl-1,3-oxathiolan-2-yl)-1,3-oxathiane?
The IUPAC name of 2-(4,5-dimethyl-1,3-oxathiolan-2-yl)-1,3-oxathiane (CID 67218267) is 2-(4,5-dimethyl-1,3-oxathiolan-2-yl)-1,3-oxathiane.
What is the SMILES notation for 2-(4,5-dimethyl-1,3-oxathiolan-2-yl)-1,3-oxathiane?
The canonical SMILES for 2-(4,5-dimethyl-1,3-oxathiolan-2-yl)-1,3-oxathiane is CC1OC(C2OCCCS2)SC1C.
What is the InChIKey of 2-(4,5-dimethyl-1,3-oxathiolan-2-yl)-1,3-oxathiane?
The InChIKey is ULNPXBWMAOUWNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2S2/c1-6-7(2)13-9(11-6)8-10-4-3-5-12-8/h6-9H,3-5H2,1-2H3.
What are the key properties of 2-(4,5-dimethyl-1,3-oxathiolan-2-yl)-1,3-oxathiane?
2-(4,5-dimethyl-1,3-oxathiolan-2-yl)-1,3-oxathiane has a molecular weight of 220.36 g/mol, XLogP of 2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethyl-1,3-oxathiolan-2-yl)-1,3-oxathiane is sourced from PubChem (CID 67218267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).