C18H30O — CID 67218541
propan-2-one;2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undec-8-ene (PubChem CID 67218541) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is propan-2-one;2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undec-8-ene.
| Compound Name | propan-2-one;2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undec-8-ene |
|---|---|
| PubChem CID | 67218541 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | propan-2-one;2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undec-8-ene |
| SMILES | CC(C)=O.CC1=CCC23CC1C(C)(C)C2CCC3C |
| InChI | InChI=1S/C15H24.C3H6O/c1-10-7-8-15-9-12(10)14(3,4)13(15)6-5-11(15)2;1-3(2)4/h7,11-13H,5-6,8-9H2,1-4H3;1-2H3 |
| InChIKey | MJXZCBGNPJYXOX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|