About methyl 6-pyridin-3-ylpyrimidine-4-carboxylate;2,2,2-trifluoroacetic acid
methyl 6-pyridin-3-ylpyrimidine-4-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 67218574) has the molecular formula C13H10F3N3O4
and a molecular weight of 329.23 g/mol. Its IUPAC name is methyl 6-pyridin-3-ylpyrimidine-4-carboxylate;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | methyl 6-pyridin-3-ylpyrimidine-4-carboxylate;2,2,2-trifluoroacetic acid |
| PubChem CID | 67218574 |
| Molecular Formula | C13H10F3N3O4 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | methyl 6-pyridin-3-ylpyrimidine-4-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)c1cc(-c2cccnc2)ncn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H9N3O2.C2HF3O2/c1-16-11(15)10-5-9(13-7-14-10)8-3-2-4-12-6-8;3-2(4,5)1(6)7/h2-7H,1H3;(H,6,7) |
| InChIKey | GRKHQMXPTYMBSY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 102.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 6-pyridin-3-ylpyrimidine-4-carboxylate;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-pyridin-3-ylpyrimidine-4-carboxylate;2,2,2-trifluoroacetic acid?
The IUPAC name of methyl 6-pyridin-3-ylpyrimidine-4-carboxylate;2,2,2-trifluoroacetic acid (CID 67218574) is methyl 6-pyridin-3-ylpyrimidine-4-carboxylate;2,2,2-trifluoroacetic acid.
What is the SMILES notation for methyl 6-pyridin-3-ylpyrimidine-4-carboxylate;2,2,2-trifluoroacetic acid?
The canonical SMILES for methyl 6-pyridin-3-ylpyrimidine-4-carboxylate;2,2,2-trifluoroacetic acid is COC(=O)c1cc(-c2cccnc2)ncn1.O=C(O)C(F)(F)F.
What is the InChIKey of methyl 6-pyridin-3-ylpyrimidine-4-carboxylate;2,2,2-trifluoroacetic acid?
The InChIKey is GRKHQMXPTYMBSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O2.C2HF3O2/c1-16-11(15)10-5-9(13-7-14-10)8-3-2-4-12-6-8;3-2(4,5)1(6)7/h2-7H,1H3;(H,6,7).
What are the key properties of methyl 6-pyridin-3-ylpyrimidine-4-carboxylate;2,2,2-trifluoroacetic acid?
methyl 6-pyridin-3-ylpyrimidine-4-carboxylate;2,2,2-trifluoroacetic acid has a molecular weight of 329.23 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-pyridin-3-ylpyrimidine-4-carboxylate;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 67218574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).