C17H11Cl2N3O — CID 67218711
6-(3,4-dichlorophenyl)-N-phenylpyrimidine-4-carboxamide (PubChem CID 67218711) has the molecular formula C17H11Cl2N3O and a molecular weight of 344.20 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-N-phenylpyrimidine-4-carboxamide.
| Compound Name | 6-(3,4-dichlorophenyl)-N-phenylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 67218711 |
| Molecular Formula | C17H11Cl2N3O |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-N-phenylpyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cc(-c2ccc(Cl)c(Cl)c2)ncn1 |
| InChI | InChI=1S/C17H11Cl2N3O/c18-13-7-6-11(8-14(13)19)15-9-16(21-10-20-15)17(23)22-12-4-2-1-3-5-12/h1-10H,(H,22,23) |
| InChIKey | IUONWXKTJPXWCF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |