About 5-sulfamoyl-1,3-thiazole-2-carboxamide
5-sulfamoyl-1,3-thiazole-2-carboxamide (PubChem CID 67218803) has the molecular formula C4H5N3O3S2
and a molecular weight of 207.24 g/mol. Its IUPAC name is 5-sulfamoyl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-sulfamoyl-1,3-thiazole-2-carboxamide |
| PubChem CID | 67218803 |
| Molecular Formula | C4H5N3O3S2 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 206.98 |
| IUPAC Name | 5-sulfamoyl-1,3-thiazole-2-carboxamide |
| SMILES | NC(=O)c1ncc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C4H5N3O3S2/c5-3(8)4-7-1-2(11-4)12(6,9)10/h1H,(H2,5,8)(H2,6,9,10) |
| InChIKey | PDTAESDQWFPKDU-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-sulfamoyl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-sulfamoyl-1,3-thiazole-2-carboxamide?
The IUPAC name of 5-sulfamoyl-1,3-thiazole-2-carboxamide (CID 67218803) is 5-sulfamoyl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 5-sulfamoyl-1,3-thiazole-2-carboxamide?
The canonical SMILES for 5-sulfamoyl-1,3-thiazole-2-carboxamide is NC(=O)c1ncc(S(N)(=O)=O)s1.
What is the InChIKey of 5-sulfamoyl-1,3-thiazole-2-carboxamide?
The InChIKey is PDTAESDQWFPKDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O3S2/c5-3(8)4-7-1-2(11-4)12(6,9)10/h1H,(H2,5,8)(H2,6,9,10).
What are the key properties of 5-sulfamoyl-1,3-thiazole-2-carboxamide?
5-sulfamoyl-1,3-thiazole-2-carboxamide has a molecular weight of 207.24 g/mol, XLogP of -1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-sulfamoyl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 67218803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).