About 5-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methyl-1,3-thiazole-2-carboxamide
5-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methyl-1,3-thiazole-2-carboxamide (PubChem CID 67218989) has the molecular formula C9H13N3O4S2
and a molecular weight of 291.35 g/mol. Its IUPAC name is 5-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methyl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methyl-1,3-thiazole-2-carboxamide |
| PubChem CID | 67218989 |
| Molecular Formula | C9H13N3O4S2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 5-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methyl-1,3-thiazole-2-carboxamide |
| SMILES | Cc1nc(C(N)=O)sc1S(=O)(=O)N1CCC(O)C1 |
| InChI | InChI=1S/C9H13N3O4S2/c1-5-9(17-8(11-5)7(10)14)18(15,16)12-3-2-6(13)4-12/h6,13H,2-4H2,1H3,(H2,10,14) |
| InChIKey | IPHWQWAWBZADNM-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methyl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methyl-1,3-thiazole-2-carboxamide?
The IUPAC name of 5-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methyl-1,3-thiazole-2-carboxamide (CID 67218989) is 5-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methyl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 5-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methyl-1,3-thiazole-2-carboxamide?
The canonical SMILES for 5-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methyl-1,3-thiazole-2-carboxamide is Cc1nc(C(N)=O)sc1S(=O)(=O)N1CCC(O)C1.
What is the InChIKey of 5-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methyl-1,3-thiazole-2-carboxamide?
The InChIKey is IPHWQWAWBZADNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O4S2/c1-5-9(17-8(11-5)7(10)14)18(15,16)12-3-2-6(13)4-12/h6,13H,2-4H2,1H3,(H2,10,14).
What are the key properties of 5-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methyl-1,3-thiazole-2-carboxamide?
5-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methyl-1,3-thiazole-2-carboxamide has a molecular weight of 291.35 g/mol, XLogP of -0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methyl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 67218989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).