About methyl 2-[1-(3,4-difluorophenyl)sulfonyl-2-methylpyrrolo[2,3-b]pyridin-3-yl]acetate
methyl 2-[1-(3,4-difluorophenyl)sulfonyl-2-methylpyrrolo[2,3-b]pyridin-3-yl]acetate (PubChem CID 67219531) has the molecular formula C17H14F2N2O4S
and a molecular weight of 380.37 g/mol. Its IUPAC name is methyl 2-[1-(3,4-difluorophenyl)sulfonyl-2-methylpyrrolo[2,3-b]pyridin-3-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[1-(3,4-difluorophenyl)sulfonyl-2-methylpyrrolo[2,3-b]pyridin-3-yl]acetate |
| PubChem CID | 67219531 |
| Molecular Formula | C17H14F2N2O4S |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | methyl 2-[1-(3,4-difluorophenyl)sulfonyl-2-methylpyrrolo[2,3-b]pyridin-3-yl]acetate |
| SMILES | COC(=O)Cc1c(C)n(S(=O)(=O)c2ccc(F)c(F)c2)c2ncccc12 |
| InChI | InChI=1S/C17H14F2N2O4S/c1-10-13(9-16(22)25-2)12-4-3-7-20-17(12)21(10)26(23,24)11-5-6-14(18)15(19)8-11/h3-8H,9H2,1-2H3 |
| InChIKey | HDEHDWULOPYIIT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[1-(3,4-difluorophenyl)sulfonyl-2-methylpyrrolo[2,3-b]pyridin-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-(3,4-difluorophenyl)sulfonyl-2-methylpyrrolo[2,3-b]pyridin-3-yl]acetate?
The IUPAC name of methyl 2-[1-(3,4-difluorophenyl)sulfonyl-2-methylpyrrolo[2,3-b]pyridin-3-yl]acetate (CID 67219531) is methyl 2-[1-(3,4-difluorophenyl)sulfonyl-2-methylpyrrolo[2,3-b]pyridin-3-yl]acetate.
What is the SMILES notation for methyl 2-[1-(3,4-difluorophenyl)sulfonyl-2-methylpyrrolo[2,3-b]pyridin-3-yl]acetate?
The canonical SMILES for methyl 2-[1-(3,4-difluorophenyl)sulfonyl-2-methylpyrrolo[2,3-b]pyridin-3-yl]acetate is COC(=O)Cc1c(C)n(S(=O)(=O)c2ccc(F)c(F)c2)c2ncccc12.
What is the InChIKey of methyl 2-[1-(3,4-difluorophenyl)sulfonyl-2-methylpyrrolo[2,3-b]pyridin-3-yl]acetate?
The InChIKey is HDEHDWULOPYIIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F2N2O4S/c1-10-13(9-16(22)25-2)12-4-3-7-20-17(12)21(10)26(23,24)11-5-6-14(18)15(19)8-11/h3-8H,9H2,1-2H3.
What are the key properties of methyl 2-[1-(3,4-difluorophenyl)sulfonyl-2-methylpyrrolo[2,3-b]pyridin-3-yl]acetate?
methyl 2-[1-(3,4-difluorophenyl)sulfonyl-2-methylpyrrolo[2,3-b]pyridin-3-yl]acetate has a molecular weight of 380.37 g/mol, XLogP of 2.58, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-(3,4-difluorophenyl)sulfonyl-2-methylpyrrolo[2,3-b]pyridin-3-yl]acetate is sourced from PubChem (CID 67219531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).