C23H33N7O3 — CID 67220794
3-[4-(cyclohexylamino)-1-ethylpyrazolo[3,4-b]pyridin-5-yl]-5-N,5-N'-diethyl-4H-1,2-oxazole-5,5-dicarboxamide (PubChem CID 67220794) has the molecular formula C23H33N7O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 3-[4-(cyclohexylamino)-1-ethylpyrazolo[3,4-b]pyridin-5-yl]-5-N,5-N'-diethyl-4H-1,2-oxazole-5,5-dicarboxamide.
| Compound Name | 3-[4-(cyclohexylamino)-1-ethylpyrazolo[3,4-b]pyridin-5-yl]-5-N,5-N'-diethyl-4H-1,2-oxazole-5,5-dicarboxamide |
|---|---|
| PubChem CID | 67220794 |
| Molecular Formula | C23H33N7O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 3-[4-(cyclohexylamino)-1-ethylpyrazolo[3,4-b]pyridin-5-yl]-5-N,5-N'-diethyl-4H-1,2-oxazole-5,5-dicarboxamide |
| SMILES | CCNC(=O)C1(C(=O)NCC)CC(c2cnc3c(cnn3CC)c2NC2CCCCC2)=NO1 |
| InChI | InChI=1S/C23H33N7O3/c1-4-24-21(31)23(22(32)25-5-2)12-18(29-33-23)16-13-26-20-17(14-27-30(20)6-3)19(16)28-15-10-8-7-9-11-15/h13-15H,4-12H2,1-3H3,(H,24,31)(H,25,32)(H,26,28) |
| InChIKey | QIMBZBQBOAPSLT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 122.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|