About (Z)-1-(4-bromophenyl)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethenamine
(Z)-1-(4-bromophenyl)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethenamine (PubChem CID 672209) has the molecular formula C13H15BrN2O
and a molecular weight of 295.18 g/mol. Its IUPAC name is (Z)-1-(4-bromophenyl)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethenamine.
Molecular Properties
| Compound Name | (Z)-1-(4-bromophenyl)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethenamine |
| PubChem CID | 672209 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | (Z)-1-(4-bromophenyl)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethenamine |
| SMILES | CC1(C)COC(/C=C(\N)c2ccc(Br)cc2)=N1 |
| InChI | InChI=1S/C13H15BrN2O/c1-13(2)8-17-12(16-13)7-11(15)9-3-5-10(14)6-4-9/h3-7H,8,15H2,1-2H3/b11-7- |
| InChIKey | WOFBGZBGIXORKC-XFFZJAGNSA-N |
| XLogP | 2.96 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-1-(4-bromophenyl)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(4-bromophenyl)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethenamine?
The IUPAC name of (Z)-1-(4-bromophenyl)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethenamine (CID 672209) is (Z)-1-(4-bromophenyl)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethenamine.
What is the SMILES notation for (Z)-1-(4-bromophenyl)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethenamine?
The canonical SMILES for (Z)-1-(4-bromophenyl)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethenamine is CC1(C)COC(/C=C(\N)c2ccc(Br)cc2)=N1.
What is the InChIKey of (Z)-1-(4-bromophenyl)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethenamine?
The InChIKey is WOFBGZBGIXORKC-XFFZJAGNSA-N. The full InChI is InChI=1S/C13H15BrN2O/c1-13(2)8-17-12(16-13)7-11(15)9-3-5-10(14)6-4-9/h3-7H,8,15H2,1-2H3/b11-7-.
What are the key properties of (Z)-1-(4-bromophenyl)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethenamine?
(Z)-1-(4-bromophenyl)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethenamine has a molecular weight of 295.18 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(4-bromophenyl)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethenamine is sourced from PubChem (CID 672209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).