C32H36N4 — CID 67221007
5,10,15,20-tetra(propan-2-yl)porphyrin (PubChem CID 67221007) has the molecular formula C32H36N4 and a molecular weight of 476.67 g/mol. Its IUPAC name is 5,10,15,20-tetra(propan-2-yl)porphyrin.
| Compound Name | 5,10,15,20-tetra(propan-2-yl)porphyrin |
|---|---|
| PubChem CID | 67221007 |
| Molecular Formula | C32H36N4 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 5,10,15,20-tetra(propan-2-yl)porphyrin |
| SMILES | CC(C)/C1=C2\C=CC(=N2)/C(C(C)C)=C2/C=CC(=N2)/C(C(C)C)=C2/C=CC(=N2)/C(C(C)C)=C2/C=CC1=N2 |
| InChI | InChI=1S/C32H36N4/c1-17(2)29-21-9-11-23(33-21)30(18(3)4)25-13-15-27(35-25)32(20(7)8)28-16-14-26(36-28)31(19(5)6)24-12-10-22(29)34-24/h9-20H,1-8H3/b29-21-,29-22-,30-23-,30-25-,31-24-,31-26-,32-27-,32-28- |
| InChIKey | VNFZNFJATBKJLZ-LJRGVBPOSA-N |
| XLogP | 7.68 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |