C16H18N4OS — CID 67221140
4-[2-(cyclohexylamino)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]phenol (PubChem CID 67221140) has the molecular formula C16H18N4OS and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-[2-(cyclohexylamino)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]phenol.
| Compound Name | 4-[2-(cyclohexylamino)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]phenol |
|---|---|
| PubChem CID | 67221140 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 4-[2-(cyclohexylamino)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]phenol |
| SMILES | Oc1ccc(-c2cn3nc(NC4CCCCC4)sc3n2)cc1 |
| InChI | InChI=1S/C16H18N4OS/c21-13-8-6-11(7-9-13)14-10-20-16(18-14)22-15(19-20)17-12-4-2-1-3-5-12/h6-10,12,21H,1-5H2,(H,17,19) |
| InChIKey | MFKAVYLSRXQORT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |