C15H17N5O2S — CID 67221934
N-[3-[2-(2-methoxyethylamino)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]phenyl]acetamide (PubChem CID 67221934) has the molecular formula C15H17N5O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is N-[3-[2-(2-methoxyethylamino)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]phenyl]acetamide.
| Compound Name | N-[3-[2-(2-methoxyethylamino)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 67221934 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-[3-[2-(2-methoxyethylamino)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]phenyl]acetamide |
| SMILES | COCCNc1nn2cc(-c3cccc(NC(C)=O)c3)nc2s1 |
| InChI | InChI=1S/C15H17N5O2S/c1-10(21)17-12-5-3-4-11(8-12)13-9-20-15(18-13)23-14(19-20)16-6-7-22-2/h3-5,8-9H,6-7H2,1-2H3,(H,16,19)(H,17,21) |
| InChIKey | WURJZLQJOYESLX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|