About 7,8-dihydropyrimido[4,5-d]pyrimidine
7,8-dihydropyrimido[4,5-d]pyrimidine (PubChem CID 67223442) has the molecular formula C6H6N4
and a molecular weight of 134.14 g/mol. Its IUPAC name is 7,8-dihydropyrimido[4,5-d]pyrimidine.
Molecular Properties
| Compound Name | 7,8-dihydropyrimido[4,5-d]pyrimidine |
| PubChem CID | 67223442 |
| Molecular Formula | C6H6N4 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 7,8-dihydropyrimido[4,5-d]pyrimidine |
| SMILES | C1=NCNc2ncncc21 |
| InChI | InChI=1S/C6H6N4/c1-5-2-8-4-10-6(5)9-3-7-1/h1-3H,4H2,(H,7,9,10) |
| InChIKey | DLIITRDFRAFNAS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7,8-dihydropyrimido[4,5-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydropyrimido[4,5-d]pyrimidine?
The IUPAC name of 7,8-dihydropyrimido[4,5-d]pyrimidine (CID 67223442) is 7,8-dihydropyrimido[4,5-d]pyrimidine.
What is the SMILES notation for 7,8-dihydropyrimido[4,5-d]pyrimidine?
The canonical SMILES for 7,8-dihydropyrimido[4,5-d]pyrimidine is C1=NCNc2ncncc21.
What is the InChIKey of 7,8-dihydropyrimido[4,5-d]pyrimidine?
The InChIKey is DLIITRDFRAFNAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4/c1-5-2-8-4-10-6(5)9-3-7-1/h1-3H,4H2,(H,7,9,10).
What are the key properties of 7,8-dihydropyrimido[4,5-d]pyrimidine?
7,8-dihydropyrimido[4,5-d]pyrimidine has a molecular weight of 134.14 g/mol, XLogP of 0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydropyrimido[4,5-d]pyrimidine is sourced from PubChem (CID 67223442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).