C8H8N2O2 — CID 67223618
4,5-dihydropyrido[3,2-f][1,4]oxazepin-3-one (PubChem CID 67223618) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is 4,5-dihydropyrido[3,2-f][1,4]oxazepin-3-one.
| Compound Name | 4,5-dihydropyrido[3,2-f][1,4]oxazepin-3-one |
|---|---|
| PubChem CID | 67223618 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 4,5-dihydropyrido[3,2-f][1,4]oxazepin-3-one |
| SMILES | O=C1COc2ncccc2CN1 |
| InChI | InChI=1S/C8H8N2O2/c11-7-5-12-8-6(4-10-7)2-1-3-9-8/h1-3H,4-5H2,(H,10,11) |
| InChIKey | IALHJTXIIOPLHR-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |